What is the density of fluorenone?
1.13 g/cm³Fluorenone / Density
What is the total mass in grams of 9-Fluorenone?
Identification of 9-Fluorenone Chemical Compound
| Chemical Formula | C13H8O |
|---|---|
| Molecular Weight | 180.20202 g/mol |
| IUPAC Name | 9H-fluoren-9-one |
| SMILES String | O=C2c1ccccc1c3ccccc23 |
| InChI | InChI=1S/C13H8O/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8H |
Which compound is more polar fluorene or 9-Fluorenone?
Fluorenone is more polar than fluorene because of its C=O. bond. Fluorenone’s spot will be lower than fluorene because of its “stickness.”
What is the structure of 9-Fluorenone?
C₁₃H₈OFluorenone / Formula
What is the density of 9-Fluorenone g ml?
0.9
| Synonyms | Diphenylene ketone;Fluorene ketone |
|---|---|
| Density (g/ml) | 0.9 |
| Boiling Point (°C) | 342 |
| Melting Point (°C) | 81-85 |
| Refractive Index | – |
What is the density of 9 Fluorenol?
Predicted data is generated using the ACD/Labs Percepta Platform – PhysChem Module
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| Vapour Pressure: | 0.0±0.9 mmHg at 25°C |
| Enthalpy of Vaporization: | 64.8±3.0 kJ/mol |
| Flash Point: | 131.3±11.5 °C |
| Index of Refraction: | 1.687 |
What are the functional groups in 9-Fluorenone?
Fluorenone is an aromatic compound containing a five-membered ring with a carbonyl group attached, and two benzene rings fused on either side. Since the carbonyl group is bonded to two other carbon atoms, the particular functional group is known as a ketone.
Is 9-Fluorenone neutral?
The purpose of this experiment is to use liquid-liquid extraction, a form of solvent extraction, to separate a mixture of an organic acid (benzoic acid), organic base (ethyl-4-aminobenzoate), and a neutral component (9-Fluorenone).
Is 9-fluorenone polar or nonpolar?
9-fluorenone has a polar C−O bond.
What functional groups are in 9-Fluorenol?
Fluoren-9-ol is a member of the class of hydroxyfluorenes that is 9H-fluorene substituted by a hydroxy group at position 9 (the non-aromatic carbon). It has a role as an animal metabolite. It is a member of hydroxyfluorenes and a secondary alcohol.
What atom or species is oxidized in the conversion of 9-Fluorenol to 9 Fluorenone?
NaOCl
The 9-fluorenone will be oxidized with NaOCl to form the ketone, 9-fluorenone.
Is 9-Fluorenone more polar than Acetylferrocene?
This makes sense with the results, since Ferrocene is nonpolar, 9fluorenone is slightly polar with its carbonyl group, and acetylferrocene is polar with its acetyl group.
Why is 9-Fluorenone organic neutral?
Is Fluorenone neutral? Benzoic acid, Ethyl-4-aminobenzoate, and 9-Fluorenone will be the compounds used to separate into their pure components. Of these compounds, they are all considered organic acids and bases and neutral organic matter.
What functional groups are in Fluorenone?
Why is Rf value calculated?
Why do we need the Rf value? Rf values in chromatography are the basic requirement of the whole experiment. These values tell us whether the analyte (solute) is more affinitive with stationary or the mobile phase.
Is 9-fluorenone neutral?
What functional groups does 9-fluorenone have?
What is the density of 9-Fluorenol?
https://www.youtube.com/watch?v=458ccOu8sM8